C24H23NO2 — CID 45202126
[1-(3-methylbenzoyl)piperidin-3-yl]-naphthalen-1-ylmethanone (PubChem CID 45202126) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is [1-(3-methylbenzoyl)piperidin-3-yl]-naphthalen-1-ylmethanone.
| Compound Name | [1-(3-methylbenzoyl)piperidin-3-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 45202126 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | [1-(3-methylbenzoyl)piperidin-3-yl]-naphthalen-1-ylmethanone |
| SMILES | Cc1cccc(C(=O)N2CCCC(C(=O)c3cccc4ccccc34)C2)c1 |
| InChI | InChI=1S/C24H23NO2/c1-17-7-4-10-19(15-17)24(27)25-14-6-11-20(16-25)23(26)22-13-5-9-18-8-2-3-12-21(18)22/h2-5,7-10,12-13,15,20H,6,11,14,16H2,1H3 |
| InChIKey | DFFWYNZOMJQDNS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |