C20H20FNO2 — CID 110394780
(4-fluorophenyl)-[1-(3-methylbenzoyl)piperidin-3-yl]methanone (PubChem CID 110394780) has the molecular formula C20H20FNO2 and a molecular weight of 325.38 g/mol. Its IUPAC name is (4-fluorophenyl)-[1-(3-methylbenzoyl)piperidin-3-yl]methanone.
| Compound Name | (4-fluorophenyl)-[1-(3-methylbenzoyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 110394780 |
| Molecular Formula | C20H20FNO2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (4-fluorophenyl)-[1-(3-methylbenzoyl)piperidin-3-yl]methanone |
| SMILES | Cc1cccc(C(=O)N2CCCC(C(=O)c3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C20H20FNO2/c1-14-4-2-5-16(12-14)20(24)22-11-3-6-17(13-22)19(23)15-7-9-18(21)10-8-15/h2,4-5,7-10,12,17H,3,6,11,13H2,1H3 |
| InChIKey | PTMOGRAXIQGHDL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |