C20H22FNO — CID 90608748
[3-(4-fluorophenyl)azepan-1-yl]-(3-methylphenyl)methanone (PubChem CID 90608748) has the molecular formula C20H22FNO and a molecular weight of 311.40 g/mol. Its IUPAC name is [3-(4-fluorophenyl)azepan-1-yl]-(3-methylphenyl)methanone.
| Compound Name | [3-(4-fluorophenyl)azepan-1-yl]-(3-methylphenyl)methanone |
|---|---|
| PubChem CID | 90608748 |
| Molecular Formula | C20H22FNO |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | [3-(4-fluorophenyl)azepan-1-yl]-(3-methylphenyl)methanone |
| SMILES | Cc1cccc(C(=O)N2CCCCC(c3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C20H22FNO/c1-15-5-4-7-17(13-15)20(23)22-12-3-2-6-18(14-22)16-8-10-19(21)11-9-16/h4-5,7-11,13,18H,2-3,6,12,14H2,1H3 |
| InChIKey | GMGDYYXPGUASQS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |