C21H24ClNO — CID 121146472
[3-(4-chlorophenyl)azepan-1-yl]-(3,5-dimethylphenyl)methanone (PubChem CID 121146472) has the molecular formula C21H24ClNO and a molecular weight of 341.88 g/mol. Its IUPAC name is [3-(4-chlorophenyl)azepan-1-yl]-(3,5-dimethylphenyl)methanone.
| Compound Name | [3-(4-chlorophenyl)azepan-1-yl]-(3,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 121146472 |
| Molecular Formula | C21H24ClNO |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | [3-(4-chlorophenyl)azepan-1-yl]-(3,5-dimethylphenyl)methanone |
| SMILES | Cc1cc(C)cc(C(=O)N2CCCCC(c3ccc(Cl)cc3)C2)c1 |
| InChI | InChI=1S/C21H24ClNO/c1-15-11-16(2)13-19(12-15)21(24)23-10-4-3-5-18(14-23)17-6-8-20(22)9-7-17/h6-9,11-13,18H,3-5,10,14H2,1-2H3 |
| InChIKey | JGZCUSOYNHFOAC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |