C20H22ClNO — CID 121146469
[3-(4-chlorophenyl)azepan-1-yl]-(2-methylphenyl)methanone (PubChem CID 121146469) has the molecular formula C20H22ClNO and a molecular weight of 327.86 g/mol. Its IUPAC name is [3-(4-chlorophenyl)azepan-1-yl]-(2-methylphenyl)methanone.
| Compound Name | [3-(4-chlorophenyl)azepan-1-yl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 121146469 |
| Molecular Formula | C20H22ClNO |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | [3-(4-chlorophenyl)azepan-1-yl]-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)N1CCCCC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H22ClNO/c1-15-6-2-3-8-19(15)20(23)22-13-5-4-7-17(14-22)16-9-11-18(21)12-10-16/h2-3,6,8-12,17H,4-5,7,13-14H2,1H3 |
| InChIKey | HISXICSSFZYTPH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |