C20H21Cl2NO2 — CID 121146503
(5-chloro-2-methoxyphenyl)-[3-(4-chlorophenyl)azepan-1-yl]methanone (PubChem CID 121146503) has the molecular formula C20H21Cl2NO2 and a molecular weight of 378.30 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)-[3-(4-chlorophenyl)azepan-1-yl]methanone.
| Compound Name | (5-chloro-2-methoxyphenyl)-[3-(4-chlorophenyl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 121146503 |
| Molecular Formula | C20H21Cl2NO2 |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)-[3-(4-chlorophenyl)azepan-1-yl]methanone |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCCCC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H21Cl2NO2/c1-25-19-10-9-17(22)12-18(19)20(24)23-11-3-2-4-15(13-23)14-5-7-16(21)8-6-14/h5-10,12,15H,2-4,11,13H2,1H3 |
| InChIKey | PMFBTQMOFNZOCL-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |