C19H18Cl3NO — CID 121146499
[3-(4-chlorophenyl)azepan-1-yl]-(2,4-dichlorophenyl)methanone (PubChem CID 121146499) has the molecular formula C19H18Cl3NO and a molecular weight of 382.72 g/mol. Its IUPAC name is [3-(4-chlorophenyl)azepan-1-yl]-(2,4-dichlorophenyl)methanone.
| Compound Name | [3-(4-chlorophenyl)azepan-1-yl]-(2,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 121146499 |
| Molecular Formula | C19H18Cl3NO |
| Molecular Weight | 382.72 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | [3-(4-chlorophenyl)azepan-1-yl]-(2,4-dichlorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1Cl)N1CCCCC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H18Cl3NO/c20-15-6-4-13(5-7-15)14-3-1-2-10-23(12-14)19(24)17-9-8-16(21)11-18(17)22/h4-9,11,14H,1-3,10,12H2 |
| InChIKey | KXWCRTJPZJFUNZ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.72 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |