C19H19ClFNO — CID 90608526
(2-chloro-4-fluorophenyl)-(3-phenylazepan-1-yl)methanone (PubChem CID 90608526) has the molecular formula C19H19ClFNO and a molecular weight of 331.82 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)-(3-phenylazepan-1-yl)methanone.
| Compound Name | (2-chloro-4-fluorophenyl)-(3-phenylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 90608526 |
| Molecular Formula | C19H19ClFNO |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (2-chloro-4-fluorophenyl)-(3-phenylazepan-1-yl)methanone |
| SMILES | O=C(c1ccc(F)cc1Cl)N1CCCCC(c2ccccc2)C1 |
| InChI | InChI=1S/C19H19ClFNO/c20-18-12-16(21)9-10-17(18)19(23)22-11-5-4-8-15(13-22)14-6-2-1-3-7-14/h1-3,6-7,9-10,12,15H,4-5,8,11,13H2 |
| InChIKey | CXIFMAFNKBZYSV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |