C19H19F2NO — CID 90608763
(2-fluorophenyl)-[3-(4-fluorophenyl)azepan-1-yl]methanone (PubChem CID 90608763) has the molecular formula C19H19F2NO and a molecular weight of 315.36 g/mol. Its IUPAC name is (2-fluorophenyl)-[3-(4-fluorophenyl)azepan-1-yl]methanone.
| Compound Name | (2-fluorophenyl)-[3-(4-fluorophenyl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 90608763 |
| Molecular Formula | C19H19F2NO |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | (2-fluorophenyl)-[3-(4-fluorophenyl)azepan-1-yl]methanone |
| SMILES | O=C(c1ccccc1F)N1CCCCC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H19F2NO/c20-16-10-8-14(9-11-16)15-5-3-4-12-22(13-15)19(23)17-6-1-2-7-18(17)21/h1-2,6-11,15H,3-5,12-13H2 |
| InChIKey | OZEURQSATNLNAA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |