C20H19F4NO2 — CID 121146325
[3-(4-fluorophenyl)azepan-1-yl]-[2-(trifluoromethoxy)phenyl]methanone (PubChem CID 121146325) has the molecular formula C20H19F4NO2 and a molecular weight of 381.37 g/mol. Its IUPAC name is [3-(4-fluorophenyl)azepan-1-yl]-[2-(trifluoromethoxy)phenyl]methanone.
| Compound Name | [3-(4-fluorophenyl)azepan-1-yl]-[2-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 121146325 |
| Molecular Formula | C20H19F4NO2 |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | [3-(4-fluorophenyl)azepan-1-yl]-[2-(trifluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1ccccc1OC(F)(F)F)N1CCCCC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H19F4NO2/c21-16-10-8-14(9-11-16)15-5-3-4-12-25(13-15)19(26)17-6-1-2-7-18(17)27-20(22,23)24/h1-2,6-11,15H,3-5,12-13H2 |
| InChIKey | UHIZPDPMSKWKPR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |