C19H19F4NO3S — CID 121146381
3-(4-fluorophenyl)-1-[2-(trifluoromethoxy)phenyl]sulfonylazepane (PubChem CID 121146381) has the molecular formula C19H19F4NO3S and a molecular weight of 417.42 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-[2-(trifluoromethoxy)phenyl]sulfonylazepane.
| Compound Name | 3-(4-fluorophenyl)-1-[2-(trifluoromethoxy)phenyl]sulfonylazepane |
|---|---|
| PubChem CID | 121146381 |
| Molecular Formula | C19H19F4NO3S |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 3-(4-fluorophenyl)-1-[2-(trifluoromethoxy)phenyl]sulfonylazepane |
| SMILES | O=S(=O)(c1ccccc1OC(F)(F)F)N1CCCCC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H19F4NO3S/c20-16-10-8-14(9-11-16)15-5-3-4-12-24(13-15)28(25,26)18-7-2-1-6-17(18)27-19(21,22)23/h1-2,6-11,15H,3-5,12-13H2 |
| InChIKey | PVSGLXRWLWBRGN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |