C13H17F3N2O3S — CID 124627734
(3R)-N-methyl-1-[2-(trifluoromethoxy)phenyl]sulfonylpiperidin-3-amine (PubChem CID 124627734) has the molecular formula C13H17F3N2O3S and a molecular weight of 338.35 g/mol. Its IUPAC name is (3R)-N-methyl-1-[2-(trifluoromethoxy)phenyl]sulfonylpiperidin-3-amine.
| Compound Name | (3R)-N-methyl-1-[2-(trifluoromethoxy)phenyl]sulfonylpiperidin-3-amine |
|---|---|
| PubChem CID | 124627734 |
| Molecular Formula | C13H17F3N2O3S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (3R)-N-methyl-1-[2-(trifluoromethoxy)phenyl]sulfonylpiperidin-3-amine |
| SMILES | CN[C@@H]1CCCN(S(=O)(=O)c2ccccc2OC(F)(F)F)C1 |
| InChI | InChI=1S/C13H17F3N2O3S/c1-17-10-5-4-8-18(9-10)22(19,20)12-7-3-2-6-11(12)21-13(14,15)16/h2-3,6-7,10,17H,4-5,8-9H2,1H3/t10-/m1/s1 |
| InChIKey | PBPPSGCIEKHXLN-SNVBAGLBSA-N |
| XLogP | 1.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |