C18H20F3N3O4S — CID 122268466
5-ethyl-2-[1-[2-(trifluoromethoxy)phenyl]sulfonylpiperidin-3-yl]oxypyrimidine (PubChem CID 122268466) has the molecular formula C18H20F3N3O4S and a molecular weight of 431.44 g/mol. Its IUPAC name is 5-ethyl-2-[1-[2-(trifluoromethoxy)phenyl]sulfonylpiperidin-3-yl]oxypyrimidine.
| Compound Name | 5-ethyl-2-[1-[2-(trifluoromethoxy)phenyl]sulfonylpiperidin-3-yl]oxypyrimidine |
|---|---|
| PubChem CID | 122268466 |
| Molecular Formula | C18H20F3N3O4S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 5-ethyl-2-[1-[2-(trifluoromethoxy)phenyl]sulfonylpiperidin-3-yl]oxypyrimidine |
| SMILES | CCc1cnc(OC2CCCN(S(=O)(=O)c3ccccc3OC(F)(F)F)C2)nc1 |
| InChI | InChI=1S/C18H20F3N3O4S/c1-2-13-10-22-17(23-11-13)27-14-6-5-9-24(12-14)29(25,26)16-8-4-3-7-15(16)28-18(19,20)21/h3-4,7-8,10-11,14H,2,5-6,9,12H2,1H3 |
| InChIKey | HHLCAFDJTMAOAO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |