C16H15F4N3O4S — CID 121018022
5-fluoro-2-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-3-yl]oxypyrimidine (PubChem CID 121018022) has the molecular formula C16H15F4N3O4S and a molecular weight of 421.37 g/mol. Its IUPAC name is 5-fluoro-2-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-3-yl]oxypyrimidine.
| Compound Name | 5-fluoro-2-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-3-yl]oxypyrimidine |
|---|---|
| PubChem CID | 121018022 |
| Molecular Formula | C16H15F4N3O4S |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 5-fluoro-2-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-3-yl]oxypyrimidine |
| SMILES | O=S(=O)(c1ccc(OC(F)(F)F)cc1)N1CCCC(Oc2ncc(F)cn2)C1 |
| InChI | InChI=1S/C16H15F4N3O4S/c17-11-8-21-15(22-9-11)26-13-2-1-7-23(10-13)28(24,25)14-5-3-12(4-6-14)27-16(18,19)20/h3-6,8-9,13H,1-2,7,10H2 |
| InChIKey | LEIRELHIECKBDX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |