C12H18FN3O3S — CID 122258659
5-fluoro-2-(1-propan-2-ylsulfonylpiperidin-3-yl)oxypyrimidine (PubChem CID 122258659) has the molecular formula C12H18FN3O3S and a molecular weight of 303.36 g/mol. Its IUPAC name is 5-fluoro-2-(1-propan-2-ylsulfonylpiperidin-3-yl)oxypyrimidine.
| Compound Name | 5-fluoro-2-(1-propan-2-ylsulfonylpiperidin-3-yl)oxypyrimidine |
|---|---|
| PubChem CID | 122258659 |
| Molecular Formula | C12H18FN3O3S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 5-fluoro-2-(1-propan-2-ylsulfonylpiperidin-3-yl)oxypyrimidine |
| SMILES | CC(C)S(=O)(=O)N1CCCC(Oc2ncc(F)cn2)C1 |
| InChI | InChI=1S/C12H18FN3O3S/c1-9(2)20(17,18)16-5-3-4-11(8-16)19-12-14-6-10(13)7-15-12/h6-7,9,11H,3-5,8H2,1-2H3 |
| InChIKey | OFSIBZDIDFVMQK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |