C13H13ClFN3O3S2 — CID 122258636
2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-3-yl]oxy-5-fluoropyrimidine (PubChem CID 122258636) has the molecular formula C13H13ClFN3O3S2 and a molecular weight of 377.85 g/mol. Its IUPAC name is 2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-3-yl]oxy-5-fluoropyrimidine.
| Compound Name | 2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-3-yl]oxy-5-fluoropyrimidine |
|---|---|
| PubChem CID | 122258636 |
| Molecular Formula | C13H13ClFN3O3S2 |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 2-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-3-yl]oxy-5-fluoropyrimidine |
| SMILES | O=S(=O)(c1ccc(Cl)s1)N1CCCC(Oc2ncc(F)cn2)C1 |
| InChI | InChI=1S/C13H13ClFN3O3S2/c14-11-3-4-12(22-11)23(19,20)18-5-1-2-10(8-18)21-13-16-6-9(15)7-17-13/h3-4,6-7,10H,1-2,5,8H2 |
| InChIKey | RTQZCFJRAOCFAM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |