C12H12FN3O3S2 — CID 129355039
5-fluoro-2-[(3R)-1-thiophen-2-ylsulfonylpyrrolidin-3-yl]oxypyrimidine (PubChem CID 129355039) has the molecular formula C12H12FN3O3S2 and a molecular weight of 329.38 g/mol. Its IUPAC name is 5-fluoro-2-[(3R)-1-thiophen-2-ylsulfonylpyrrolidin-3-yl]oxypyrimidine.
| Compound Name | 5-fluoro-2-[(3R)-1-thiophen-2-ylsulfonylpyrrolidin-3-yl]oxypyrimidine |
|---|---|
| PubChem CID | 129355039 |
| Molecular Formula | C12H12FN3O3S2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 5-fluoro-2-[(3R)-1-thiophen-2-ylsulfonylpyrrolidin-3-yl]oxypyrimidine |
| SMILES | O=S(=O)(c1cccs1)N1CC[C@@H](Oc2ncc(F)cn2)C1 |
| InChI | InChI=1S/C12H12FN3O3S2/c13-9-6-14-12(15-7-9)19-10-3-4-16(8-10)21(17,18)11-2-1-5-20-11/h1-2,5-7,10H,3-4,8H2/t10-/m1/s1 |
| InChIKey | CWAKDHSLXFGBSC-SNVBAGLBSA-N |
| XLogP | 1.52 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |