C14H15ClN2O3S2 — CID 71798965
5-chloro-2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)oxypyridine (PubChem CID 71798965) has the molecular formula C14H15ClN2O3S2 and a molecular weight of 358.87 g/mol. Its IUPAC name is 5-chloro-2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)oxypyridine.
| Compound Name | 5-chloro-2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)oxypyridine |
|---|---|
| PubChem CID | 71798965 |
| Molecular Formula | C14H15ClN2O3S2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 5-chloro-2-(1-thiophen-2-ylsulfonylpiperidin-4-yl)oxypyridine |
| SMILES | O=S(=O)(c1cccs1)N1CCC(Oc2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C14H15ClN2O3S2/c15-11-3-4-13(16-10-11)20-12-5-7-17(8-6-12)22(18,19)14-2-1-9-21-14/h1-4,9-10,12H,5-8H2 |
| InChIKey | KNCLXLRKTIKSIS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |