C15H19N3O3S2 — CID 121161086
2,4-dimethyl-6-(1-thiophen-2-ylsulfonylpiperidin-4-yl)oxypyrimidine (PubChem CID 121161086) has the molecular formula C15H19N3O3S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 2,4-dimethyl-6-(1-thiophen-2-ylsulfonylpiperidin-4-yl)oxypyrimidine.
| Compound Name | 2,4-dimethyl-6-(1-thiophen-2-ylsulfonylpiperidin-4-yl)oxypyrimidine |
|---|---|
| PubChem CID | 121161086 |
| Molecular Formula | C15H19N3O3S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2,4-dimethyl-6-(1-thiophen-2-ylsulfonylpiperidin-4-yl)oxypyrimidine |
| SMILES | Cc1cc(OC2CCN(S(=O)(=O)c3cccs3)CC2)nc(C)n1 |
| InChI | InChI=1S/C15H19N3O3S2/c1-11-10-14(17-12(2)16-11)21-13-5-7-18(8-6-13)23(19,20)15-4-3-9-22-15/h3-4,9-10,13H,5-8H2,1-2H3 |
| InChIKey | HPCGKBYTZZBRPC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |