C20H25FN2O3S2 — CID 86264461
4-[4-(2-fluorophenoxy)piperidin-1-yl]-1-thiophen-2-ylsulfonylpiperidine (PubChem CID 86264461) has the molecular formula C20H25FN2O3S2 and a molecular weight of 424.56 g/mol. Its IUPAC name is 4-[4-(2-fluorophenoxy)piperidin-1-yl]-1-thiophen-2-ylsulfonylpiperidine.
| Compound Name | 4-[4-(2-fluorophenoxy)piperidin-1-yl]-1-thiophen-2-ylsulfonylpiperidine |
|---|---|
| PubChem CID | 86264461 |
| Molecular Formula | C20H25FN2O3S2 |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 4-[4-(2-fluorophenoxy)piperidin-1-yl]-1-thiophen-2-ylsulfonylpiperidine |
| SMILES | O=S(=O)(c1cccs1)N1CCC(N2CCC(Oc3ccccc3F)CC2)CC1 |
| InChI | InChI=1S/C20H25FN2O3S2/c21-18-4-1-2-5-19(18)26-17-9-11-22(12-10-17)16-7-13-23(14-8-16)28(24,25)20-6-3-15-27-20/h1-6,15-17H,7-14H2 |
| InChIKey | DSVYYOKLMDDGDF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |