C25H33FN2O4S — CID 90617029
1-(5-ethyl-2-methoxyphenyl)sulfonyl-4-[4-(2-fluorophenoxy)piperidin-1-yl]piperidine (PubChem CID 90617029) has the molecular formula C25H33FN2O4S and a molecular weight of 476.61 g/mol. Its IUPAC name is 1-(5-ethyl-2-methoxyphenyl)sulfonyl-4-[4-(2-fluorophenoxy)piperidin-1-yl]piperidine.
| Compound Name | 1-(5-ethyl-2-methoxyphenyl)sulfonyl-4-[4-(2-fluorophenoxy)piperidin-1-yl]piperidine |
|---|---|
| PubChem CID | 90617029 |
| Molecular Formula | C25H33FN2O4S |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 1-(5-ethyl-2-methoxyphenyl)sulfonyl-4-[4-(2-fluorophenoxy)piperidin-1-yl]piperidine |
| SMILES | CCc1ccc(OC)c(S(=O)(=O)N2CCC(N3CCC(Oc4ccccc4F)CC3)CC2)c1 |
| InChI | InChI=1S/C25H33FN2O4S/c1-3-19-8-9-24(31-2)25(18-19)33(29,30)28-16-10-20(11-17-28)27-14-12-21(13-15-27)32-23-7-5-4-6-22(23)26/h4-9,18,20-21H,3,10-17H2,1-2H3 |
| InChIKey | ASMIPYLXLUHVJT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |