C17H25ClN2O4S — CID 134161125
1-(5-chloro-2-methoxyphenyl)sulfonyl-4-(3-methoxypyrrolidin-1-yl)piperidine (PubChem CID 134161125) has the molecular formula C17H25ClN2O4S and a molecular weight of 388.92 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)sulfonyl-4-(3-methoxypyrrolidin-1-yl)piperidine.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)sulfonyl-4-(3-methoxypyrrolidin-1-yl)piperidine |
|---|---|
| PubChem CID | 134161125 |
| Molecular Formula | C17H25ClN2O4S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)sulfonyl-4-(3-methoxypyrrolidin-1-yl)piperidine |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N1CCC(N2CCC(OC)C2)CC1 |
| InChI | InChI=1S/C17H25ClN2O4S/c1-23-15-7-8-19(12-15)14-5-9-20(10-6-14)25(21,22)17-11-13(18)3-4-16(17)24-2/h3-4,11,14-15H,5-10,12H2,1-2H3 |
| InChIKey | GWKRUPYPEWYYFQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |