C17H20ClN3O5S — CID 121161732
4-[1-(5-chloro-2-methoxyphenyl)sulfonylpiperidin-4-yl]oxy-2-methoxypyrimidine (PubChem CID 121161732) has the molecular formula C17H20ClN3O5S and a molecular weight of 413.88 g/mol. Its IUPAC name is 4-[1-(5-chloro-2-methoxyphenyl)sulfonylpiperidin-4-yl]oxy-2-methoxypyrimidine.
| Compound Name | 4-[1-(5-chloro-2-methoxyphenyl)sulfonylpiperidin-4-yl]oxy-2-methoxypyrimidine |
|---|---|
| PubChem CID | 121161732 |
| Molecular Formula | C17H20ClN3O5S |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 4-[1-(5-chloro-2-methoxyphenyl)sulfonylpiperidin-4-yl]oxy-2-methoxypyrimidine |
| SMILES | COc1nccc(OC2CCN(S(=O)(=O)c3cc(Cl)ccc3OC)CC2)n1 |
| InChI | InChI=1S/C17H20ClN3O5S/c1-24-14-4-3-12(18)11-15(14)27(22,23)21-9-6-13(7-10-21)26-16-5-8-19-17(20-16)25-2/h3-5,8,11,13H,6-7,9-10H2,1-2H3 |
| InChIKey | ZBPNXDYDSDRZOP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |