C18H23N3O6S — CID 122261639
4-[1-(2,5-dimethoxyphenyl)sulfonylpiperidin-3-yl]oxy-2-methoxypyrimidine (PubChem CID 122261639) has the molecular formula C18H23N3O6S and a molecular weight of 409.46 g/mol. Its IUPAC name is 4-[1-(2,5-dimethoxyphenyl)sulfonylpiperidin-3-yl]oxy-2-methoxypyrimidine.
| Compound Name | 4-[1-(2,5-dimethoxyphenyl)sulfonylpiperidin-3-yl]oxy-2-methoxypyrimidine |
|---|---|
| PubChem CID | 122261639 |
| Molecular Formula | C18H23N3O6S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 4-[1-(2,5-dimethoxyphenyl)sulfonylpiperidin-3-yl]oxy-2-methoxypyrimidine |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCCC(Oc3ccnc(OC)n3)C2)c1 |
| InChI | InChI=1S/C18H23N3O6S/c1-24-13-6-7-15(25-2)16(11-13)28(22,23)21-10-4-5-14(12-21)27-17-8-9-19-18(20-17)26-3/h6-9,11,14H,4-5,10,12H2,1-3H3 |
| InChIKey | WZBVIIMPLUXXOK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 100.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |