C16H19N3O5S — CID 90636364
2-[1-(2,5-dimethoxyphenyl)sulfonylpyrrolidin-3-yl]oxypyrazine (PubChem CID 90636364) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is 2-[1-(2,5-dimethoxyphenyl)sulfonylpyrrolidin-3-yl]oxypyrazine.
| Compound Name | 2-[1-(2,5-dimethoxyphenyl)sulfonylpyrrolidin-3-yl]oxypyrazine |
|---|---|
| PubChem CID | 90636364 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 2-[1-(2,5-dimethoxyphenyl)sulfonylpyrrolidin-3-yl]oxypyrazine |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCC(Oc3cnccn3)C2)c1 |
| InChI | InChI=1S/C16H19N3O5S/c1-22-12-3-4-14(23-2)15(9-12)25(20,21)19-8-5-13(11-19)24-16-10-17-6-7-18-16/h3-4,6-7,9-10,13H,5,8,11H2,1-2H3 |
| InChIKey | PNJCMEYIDNUMKS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |