C14H14ClN3O3S — CID 90636398
2-[1-(3-chlorophenyl)sulfonylpyrrolidin-3-yl]oxypyrazine (PubChem CID 90636398) has the molecular formula C14H14ClN3O3S and a molecular weight of 339.80 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)sulfonylpyrrolidin-3-yl]oxypyrazine.
| Compound Name | 2-[1-(3-chlorophenyl)sulfonylpyrrolidin-3-yl]oxypyrazine |
|---|---|
| PubChem CID | 90636398 |
| Molecular Formula | C14H14ClN3O3S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 2-[1-(3-chlorophenyl)sulfonylpyrrolidin-3-yl]oxypyrazine |
| SMILES | O=S(=O)(c1cccc(Cl)c1)N1CCC(Oc2cnccn2)C1 |
| InChI | InChI=1S/C14H14ClN3O3S/c15-11-2-1-3-13(8-11)22(19,20)18-7-4-12(10-18)21-14-9-16-5-6-17-14/h1-3,5-6,8-9,12H,4,7,10H2 |
| InChIKey | KCRWJLVQWVRXEQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |