C15H14F2N2O3S — CID 129416787
2-[(3R)-1-(3,4-difluorophenyl)sulfonylpyrrolidin-3-yl]oxypyridine (PubChem CID 129416787) has the molecular formula C15H14F2N2O3S and a molecular weight of 340.35 g/mol. Its IUPAC name is 2-[(3R)-1-(3,4-difluorophenyl)sulfonylpyrrolidin-3-yl]oxypyridine.
| Compound Name | 2-[(3R)-1-(3,4-difluorophenyl)sulfonylpyrrolidin-3-yl]oxypyridine |
|---|---|
| PubChem CID | 129416787 |
| Molecular Formula | C15H14F2N2O3S |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-[(3R)-1-(3,4-difluorophenyl)sulfonylpyrrolidin-3-yl]oxypyridine |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1)N1CC[C@@H](Oc2ccccn2)C1 |
| InChI | InChI=1S/C15H14F2N2O3S/c16-13-5-4-12(9-14(13)17)23(20,21)19-8-6-11(10-19)22-15-3-1-2-7-18-15/h1-5,7,9,11H,6,8,10H2/t11-/m1/s1 |
| InChIKey | HJRAJCSKGOLVJR-LLVKDONJSA-N |
| XLogP | 2.20 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |