C15H17N3O4S — CID 90636391
2-[1-(2-methoxyphenyl)sulfonylpyrrolidin-3-yl]oxypyrazine (PubChem CID 90636391) has the molecular formula C15H17N3O4S and a molecular weight of 335.38 g/mol. Its IUPAC name is 2-[1-(2-methoxyphenyl)sulfonylpyrrolidin-3-yl]oxypyrazine.
| Compound Name | 2-[1-(2-methoxyphenyl)sulfonylpyrrolidin-3-yl]oxypyrazine |
|---|---|
| PubChem CID | 90636391 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-[1-(2-methoxyphenyl)sulfonylpyrrolidin-3-yl]oxypyrazine |
| SMILES | COc1ccccc1S(=O)(=O)N1CCC(Oc2cnccn2)C1 |
| InChI | InChI=1S/C15H17N3O4S/c1-21-13-4-2-3-5-14(13)23(19,20)18-9-6-12(11-18)22-15-10-16-7-8-17-15/h2-5,7-8,10,12H,6,9,11H2,1H3 |
| InChIKey | HOLBDRYCFCYWIB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |