C17H21N3O5S — CID 122261630
2-methoxy-4-[1-(4-methoxyphenyl)sulfonylpiperidin-3-yl]oxypyrimidine (PubChem CID 122261630) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is 2-methoxy-4-[1-(4-methoxyphenyl)sulfonylpiperidin-3-yl]oxypyrimidine.
| Compound Name | 2-methoxy-4-[1-(4-methoxyphenyl)sulfonylpiperidin-3-yl]oxypyrimidine |
|---|---|
| PubChem CID | 122261630 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-methoxy-4-[1-(4-methoxyphenyl)sulfonylpiperidin-3-yl]oxypyrimidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(Oc3ccnc(OC)n3)C2)cc1 |
| InChI | InChI=1S/C17H21N3O5S/c1-23-13-5-7-15(8-6-13)26(21,22)20-11-3-4-14(12-20)25-16-9-10-18-17(19-16)24-2/h5-10,14H,3-4,11-12H2,1-2H3 |
| InChIKey | VQDZWOMWPBDLMR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |