C16H17F2N3O4S — CID 122261674
4-[1-(2,6-difluorophenyl)sulfonylpiperidin-3-yl]oxy-2-methoxypyrimidine (PubChem CID 122261674) has the molecular formula C16H17F2N3O4S and a molecular weight of 385.39 g/mol. Its IUPAC name is 4-[1-(2,6-difluorophenyl)sulfonylpiperidin-3-yl]oxy-2-methoxypyrimidine.
| Compound Name | 4-[1-(2,6-difluorophenyl)sulfonylpiperidin-3-yl]oxy-2-methoxypyrimidine |
|---|---|
| PubChem CID | 122261674 |
| Molecular Formula | C16H17F2N3O4S |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 4-[1-(2,6-difluorophenyl)sulfonylpiperidin-3-yl]oxy-2-methoxypyrimidine |
| SMILES | COc1nccc(OC2CCCN(S(=O)(=O)c3c(F)cccc3F)C2)n1 |
| InChI | InChI=1S/C16H17F2N3O4S/c1-24-16-19-8-7-14(20-16)25-11-4-3-9-21(10-11)26(22,23)15-12(17)5-2-6-13(15)18/h2,5-8,11H,3-4,9-10H2,1H3 |
| InChIKey | JASJZJTYFOTYKE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |