C18H23N3O4S — CID 122261682
4-[1-(4-ethylphenyl)sulfonylpiperidin-3-yl]oxy-2-methoxypyrimidine (PubChem CID 122261682) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is 4-[1-(4-ethylphenyl)sulfonylpiperidin-3-yl]oxy-2-methoxypyrimidine.
| Compound Name | 4-[1-(4-ethylphenyl)sulfonylpiperidin-3-yl]oxy-2-methoxypyrimidine |
|---|---|
| PubChem CID | 122261682 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 4-[1-(4-ethylphenyl)sulfonylpiperidin-3-yl]oxy-2-methoxypyrimidine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCCC(Oc3ccnc(OC)n3)C2)cc1 |
| InChI | InChI=1S/C18H23N3O4S/c1-3-14-6-8-16(9-7-14)26(22,23)21-12-4-5-15(13-21)25-17-10-11-19-18(20-17)24-2/h6-11,15H,3-5,12-13H2,1-2H3 |
| InChIKey | DPFRPMDZGBVRMG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |