C17H20ClN3O3S — CID 122259645
5-chloro-2-[1-(4-ethylphenyl)sulfonylpiperidin-3-yl]oxypyrimidine (PubChem CID 122259645) has the molecular formula C17H20ClN3O3S and a molecular weight of 381.89 g/mol. Its IUPAC name is 5-chloro-2-[1-(4-ethylphenyl)sulfonylpiperidin-3-yl]oxypyrimidine.
| Compound Name | 5-chloro-2-[1-(4-ethylphenyl)sulfonylpiperidin-3-yl]oxypyrimidine |
|---|---|
| PubChem CID | 122259645 |
| Molecular Formula | C17H20ClN3O3S |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 5-chloro-2-[1-(4-ethylphenyl)sulfonylpiperidin-3-yl]oxypyrimidine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCCC(Oc3ncc(Cl)cn3)C2)cc1 |
| InChI | InChI=1S/C17H20ClN3O3S/c1-2-13-5-7-16(8-6-13)25(22,23)21-9-3-4-15(12-21)24-17-19-10-14(18)11-20-17/h5-8,10-11,15H,2-4,9,12H2,1H3 |
| InChIKey | GLRWARIMNDRUJS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |