C16H17Cl2N3O4S — CID 119100836
5-chloro-2-[1-(5-chloro-2-methoxyphenyl)sulfonylpiperidin-3-yl]oxypyrimidine (PubChem CID 119100836) has the molecular formula C16H17Cl2N3O4S and a molecular weight of 418.30 g/mol. Its IUPAC name is 5-chloro-2-[1-(5-chloro-2-methoxyphenyl)sulfonylpiperidin-3-yl]oxypyrimidine.
| Compound Name | 5-chloro-2-[1-(5-chloro-2-methoxyphenyl)sulfonylpiperidin-3-yl]oxypyrimidine |
|---|---|
| PubChem CID | 119100836 |
| Molecular Formula | C16H17Cl2N3O4S |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 5-chloro-2-[1-(5-chloro-2-methoxyphenyl)sulfonylpiperidin-3-yl]oxypyrimidine |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N1CCCC(Oc2ncc(Cl)cn2)C1 |
| InChI | InChI=1S/C16H17Cl2N3O4S/c1-24-14-5-4-11(17)7-15(14)26(22,23)21-6-2-3-13(10-21)25-16-19-8-12(18)9-20-16/h4-5,7-9,13H,2-3,6,10H2,1H3 |
| InChIKey | VPMYGCJDJCJWTO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |