C17H19Cl2N3O3S — CID 122268440
2-[1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]oxy-5-ethylpyrimidine (PubChem CID 122268440) has the molecular formula C17H19Cl2N3O3S and a molecular weight of 416.33 g/mol. Its IUPAC name is 2-[1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]oxy-5-ethylpyrimidine.
| Compound Name | 2-[1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]oxy-5-ethylpyrimidine |
|---|---|
| PubChem CID | 122268440 |
| Molecular Formula | C17H19Cl2N3O3S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 2-[1-(2,5-dichlorophenyl)sulfonylpiperidin-3-yl]oxy-5-ethylpyrimidine |
| SMILES | CCc1cnc(OC2CCCN(S(=O)(=O)c3cc(Cl)ccc3Cl)C2)nc1 |
| InChI | InChI=1S/C17H19Cl2N3O3S/c1-2-12-9-20-17(21-10-12)25-14-4-3-7-22(11-14)26(23,24)16-8-13(18)5-6-15(16)19/h5-6,8-10,14H,2-4,7,11H2,1H3 |
| InChIKey | PCDPDOWFDQIXII-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |