C17H21N3O5S2 — CID 122268434
methyl 3-[3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]sulfonylthiophene-2-carboxylate (PubChem CID 122268434) has the molecular formula C17H21N3O5S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is methyl 3-[3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]sulfonylthiophene-2-carboxylate.
| Compound Name | methyl 3-[3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]sulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 122268434 |
| Molecular Formula | C17H21N3O5S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | methyl 3-[3-(5-ethylpyrimidin-2-yl)oxypiperidin-1-yl]sulfonylthiophene-2-carboxylate |
| SMILES | CCc1cnc(OC2CCCN(S(=O)(=O)c3ccsc3C(=O)OC)C2)nc1 |
| InChI | InChI=1S/C17H21N3O5S2/c1-3-12-9-18-17(19-10-12)25-13-5-4-7-20(11-13)27(22,23)14-6-8-26-15(14)16(21)24-2/h6,8-10,13H,3-5,7,11H2,1-2H3 |
| InChIKey | GTVHYSSLKZAADP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |