C12H17NO5S2 — CID 114680534
methyl 3-(4-hydroxy-3-methylpiperidin-1-yl)sulfonylthiophene-2-carboxylate (PubChem CID 114680534) has the molecular formula C12H17NO5S2 and a molecular weight of 319.40 g/mol. Its IUPAC name is methyl 3-(4-hydroxy-3-methylpiperidin-1-yl)sulfonylthiophene-2-carboxylate.
| Compound Name | methyl 3-(4-hydroxy-3-methylpiperidin-1-yl)sulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 114680534 |
| Molecular Formula | C12H17NO5S2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | methyl 3-(4-hydroxy-3-methylpiperidin-1-yl)sulfonylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)N1CCC(O)C(C)C1 |
| InChI | InChI=1S/C12H17NO5S2/c1-8-7-13(5-3-9(8)14)20(16,17)10-4-6-19-11(10)12(15)18-2/h4,6,8-9,14H,3,5,7H2,1-2H3 |
| InChIKey | SWWYWCKCXYIOIJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |