C17H19NO4S2 — CID 39698835
methyl 3-(4-phenylpiperidin-1-yl)sulfonylthiophene-2-carboxylate (PubChem CID 39698835) has the molecular formula C17H19NO4S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is methyl 3-(4-phenylpiperidin-1-yl)sulfonylthiophene-2-carboxylate.
| Compound Name | methyl 3-(4-phenylpiperidin-1-yl)sulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 39698835 |
| Molecular Formula | C17H19NO4S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | methyl 3-(4-phenylpiperidin-1-yl)sulfonylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H19NO4S2/c1-22-17(19)16-15(9-12-23-16)24(20,21)18-10-7-14(8-11-18)13-5-3-2-4-6-13/h2-6,9,12,14H,7-8,10-11H2,1H3 |
| InChIKey | ZVSIEGXZHKWSAE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |