C10H15ClN2O4S2 — CID 119961772
methyl 3-piperazin-1-ylsulfonylthiophene-2-carboxylate;hydrochloride (PubChem CID 119961772) has the molecular formula C10H15ClN2O4S2 and a molecular weight of 326.83 g/mol. Its IUPAC name is methyl 3-piperazin-1-ylsulfonylthiophene-2-carboxylate;hydrochloride.
| Compound Name | methyl 3-piperazin-1-ylsulfonylthiophene-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 119961772 |
| Molecular Formula | C10H15ClN2O4S2 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | methyl 3-piperazin-1-ylsulfonylthiophene-2-carboxylate;hydrochloride |
| SMILES | COC(=O)c1sccc1S(=O)(=O)N1CCNCC1.Cl |
| InChI | InChI=1S/C10H14N2O4S2.ClH/c1-16-10(13)9-8(2-7-17-9)18(14,15)12-5-3-11-4-6-12;/h2,7,11H,3-6H2,1H3;1H |
| InChIKey | BRICHGZISZQUKI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |