C11H16N2O4S2 — CID 104975164
methyl 3-[(3R)-3-methylpiperazin-1-yl]sulfonylthiophene-2-carboxylate (PubChem CID 104975164) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is methyl 3-[(3R)-3-methylpiperazin-1-yl]sulfonylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(3R)-3-methylpiperazin-1-yl]sulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 104975164 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | methyl 3-[(3R)-3-methylpiperazin-1-yl]sulfonylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)N1CCN[C@H](C)C1 |
| InChI | InChI=1S/C11H16N2O4S2/c1-8-7-13(5-4-12-8)19(15,16)9-3-6-18-10(9)11(14)17-2/h3,6,8,12H,4-5,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | JGHYSKBAOZEXNE-MRVPVSSYSA-N |
| XLogP | 0.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |