C10H14N2O4S2 — CID 16646038
methyl 3-piperazin-1-ylsulfonylthiophene-2-carboxylate (PubChem CID 16646038) has the molecular formula C10H14N2O4S2 and a molecular weight of 290.37 g/mol. Its IUPAC name is methyl 3-piperazin-1-ylsulfonylthiophene-2-carboxylate.
| Compound Name | methyl 3-piperazin-1-ylsulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 16646038 |
| Molecular Formula | C10H14N2O4S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | methyl 3-piperazin-1-ylsulfonylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C10H14N2O4S2/c1-16-10(13)9-8(2-7-17-9)18(14,15)12-5-3-11-4-6-12/h2,7,11H,3-6H2,1H3 |
| InChIKey | OXJRZGREVONVSQ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |