C12H16N2O4S2 — CID 43597562
methyl 3-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]sulfonyl]thiophene-2-carboxylate (PubChem CID 43597562) has the molecular formula C12H16N2O4S2 and a molecular weight of 316.40 g/mol. Its IUPAC name is methyl 3-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]sulfonyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]sulfonyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 43597562 |
| Molecular Formula | C12H16N2O4S2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | methyl 3-[[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]sulfonyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C12H16N2O4S2/c1-18-12(15)11-10(3-5-19-11)20(16,17)14-4-2-8-6-13-7-9(8)14/h3,5,8-9,13H,2,4,6-7H2,1H3/t8-,9+/m0/s1 |
| InChIKey | BOVPAMMZCUPFJK-DTWKUNHWSA-N |
| XLogP | 0.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |