C11H15NO5S2 — CID 94113436
methyl 3-[(3R)-3-methylmorpholin-4-yl]sulfonylthiophene-2-carboxylate (PubChem CID 94113436) has the molecular formula C11H15NO5S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is methyl 3-[(3R)-3-methylmorpholin-4-yl]sulfonylthiophene-2-carboxylate.
| Compound Name | methyl 3-[(3R)-3-methylmorpholin-4-yl]sulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 94113436 |
| Molecular Formula | C11H15NO5S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | methyl 3-[(3R)-3-methylmorpholin-4-yl]sulfonylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)N1CCOC[C@H]1C |
| InChI | InChI=1S/C11H15NO5S2/c1-8-7-17-5-4-12(8)19(14,15)9-3-6-18-10(9)11(13)16-2/h3,6,8H,4-5,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | WLAWWYRRPXDSHT-MRVPVSSYSA-N |
| XLogP | 0.94 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |