C17H19NO5S2 — CID 18148414
methyl 3-[2-(4-methoxyphenyl)pyrrolidin-1-yl]sulfonylthiophene-2-carboxylate (PubChem CID 18148414) has the molecular formula C17H19NO5S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is methyl 3-[2-(4-methoxyphenyl)pyrrolidin-1-yl]sulfonylthiophene-2-carboxylate.
| Compound Name | methyl 3-[2-(4-methoxyphenyl)pyrrolidin-1-yl]sulfonylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 18148414 |
| Molecular Formula | C17H19NO5S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | methyl 3-[2-(4-methoxyphenyl)pyrrolidin-1-yl]sulfonylthiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)N1CCCC1c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H19NO5S2/c1-22-13-7-5-12(6-8-13)14-4-3-10-18(14)25(20,21)15-9-11-24-16(15)17(19)23-2/h5-9,11,14H,3-4,10H2,1-2H3 |
| InChIKey | PJSBFWVKPGZVPX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |