C9H14N2O2S2 — CID 66582369
(3S)-3-methyl-1-thiophen-2-ylsulfonylpiperazine (PubChem CID 66582369) has the molecular formula C9H14N2O2S2 and a molecular weight of 246.36 g/mol. Its IUPAC name is (3S)-3-methyl-1-thiophen-2-ylsulfonylpiperazine.
| Compound Name | (3S)-3-methyl-1-thiophen-2-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 66582369 |
| Molecular Formula | C9H14N2O2S2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | (3S)-3-methyl-1-thiophen-2-ylsulfonylpiperazine |
| SMILES | C[C@H]1CN(S(=O)(=O)c2cccs2)CCN1 |
| InChI | InChI=1S/C9H14N2O2S2/c1-8-7-11(5-4-10-8)15(12,13)9-3-2-6-14-9/h2-3,6,8,10H,4-5,7H2,1H3/t8-/m0/s1 |
| InChIKey | JOIBOXBEEZDBJD-QMMMGPOBSA-N |
| XLogP | 0.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |