C9H12N2O4S2 — CID 97169349
(2R)-4-thiophen-2-ylsulfonylpiperazine-2-carboxylic acid (PubChem CID 97169349) has the molecular formula C9H12N2O4S2 and a molecular weight of 276.34 g/mol. Its IUPAC name is (2R)-4-thiophen-2-ylsulfonylpiperazine-2-carboxylic acid.
| Compound Name | (2R)-4-thiophen-2-ylsulfonylpiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 97169349 |
| Molecular Formula | C9H12N2O4S2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | (2R)-4-thiophen-2-ylsulfonylpiperazine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN(S(=O)(=O)c2cccs2)CCN1 |
| InChI | InChI=1S/C9H12N2O4S2/c12-9(13)7-6-11(4-3-10-7)17(14,15)8-2-1-5-16-8/h1-2,5,7,10H,3-4,6H2,(H,12,13)/t7-/m1/s1 |
| InChIKey | GICZDSIURUBIIM-SSDOTTSWSA-N |
| XLogP | -0.20 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |