C10H12ClNO3S2 — CID 42261450
(3R)-1-thiophen-2-ylsulfonylpiperidine-3-carbonyl chloride (PubChem CID 42261450) has the molecular formula C10H12ClNO3S2 and a molecular weight of 293.80 g/mol. Its IUPAC name is (3R)-1-thiophen-2-ylsulfonylpiperidine-3-carbonyl chloride.
| Compound Name | (3R)-1-thiophen-2-ylsulfonylpiperidine-3-carbonyl chloride |
|---|---|
| PubChem CID | 42261450 |
| Molecular Formula | C10H12ClNO3S2 |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | (3R)-1-thiophen-2-ylsulfonylpiperidine-3-carbonyl chloride |
| SMILES | O=C(Cl)[C@@H]1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C10H12ClNO3S2/c11-10(13)8-3-1-5-12(7-8)17(14,15)9-4-2-6-16-9/h2,4,6,8H,1,3,5,7H2/t8-/m1/s1 |
| InChIKey | MNKMVTYIWZGYED-MRVPVSSYSA-N |
| XLogP | 1.91 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|