C16H24N2O3S2 — CID 51607049
[(3S)-3-methylpiperidin-1-yl]-[(3R)-1-thiophen-2-ylsulfonylpiperidin-3-yl]methanone (PubChem CID 51607049) has the molecular formula C16H24N2O3S2 and a molecular weight of 356.51 g/mol. Its IUPAC name is [(3S)-3-methylpiperidin-1-yl]-[(3R)-1-thiophen-2-ylsulfonylpiperidin-3-yl]methanone.
| Compound Name | [(3S)-3-methylpiperidin-1-yl]-[(3R)-1-thiophen-2-ylsulfonylpiperidin-3-yl]methanone |
|---|---|
| PubChem CID | 51607049 |
| Molecular Formula | C16H24N2O3S2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | [(3S)-3-methylpiperidin-1-yl]-[(3R)-1-thiophen-2-ylsulfonylpiperidin-3-yl]methanone |
| SMILES | C[C@H]1CCCN(C(=O)[C@@H]2CCCN(S(=O)(=O)c3cccs3)C2)C1 |
| InChI | InChI=1S/C16H24N2O3S2/c1-13-5-2-8-17(11-13)16(19)14-6-3-9-18(12-14)23(20,21)15-7-4-10-22-15/h4,7,10,13-14H,2-3,5-6,8-9,11-12H2,1H3/t13-,14+/m0/s1 |
| InChIKey | VAEWZCLJMDKHSX-UONOGXRCSA-N |
| XLogP | 2.41 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |