C21H31N3O4S2 — CID 55428093
piperidin-1-yl-[1-(1-thiophen-2-ylsulfonylpiperidine-3-carbonyl)piperidin-4-yl]methanone (PubChem CID 55428093) has the molecular formula C21H31N3O4S2 and a molecular weight of 453.63 g/mol. Its IUPAC name is piperidin-1-yl-[1-(1-thiophen-2-ylsulfonylpiperidine-3-carbonyl)piperidin-4-yl]methanone.
| Compound Name | piperidin-1-yl-[1-(1-thiophen-2-ylsulfonylpiperidine-3-carbonyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 55428093 |
| Molecular Formula | C21H31N3O4S2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | piperidin-1-yl-[1-(1-thiophen-2-ylsulfonylpiperidine-3-carbonyl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(C(=O)C2CCCN(S(=O)(=O)c3cccs3)C2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C21H31N3O4S2/c25-20(22-10-2-1-3-11-22)17-8-13-23(14-9-17)21(26)18-6-4-12-24(16-18)30(27,28)19-7-5-15-29-19/h5,7,15,17-18H,1-4,6,8-14,16H2 |
| InChIKey | VHWGZNLIPDLDLN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |