C18H26N2O5S2 — CID 31943086
ethyl 1-[(3S)-1-thiophen-2-ylsulfonylpiperidine-3-carbonyl]piperidine-4-carboxylate (PubChem CID 31943086) has the molecular formula C18H26N2O5S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is ethyl 1-[(3S)-1-thiophen-2-ylsulfonylpiperidine-3-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(3S)-1-thiophen-2-ylsulfonylpiperidine-3-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 31943086 |
| Molecular Formula | C18H26N2O5S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | ethyl 1-[(3S)-1-thiophen-2-ylsulfonylpiperidine-3-carbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)[C@H]2CCCN(S(=O)(=O)c3cccs3)C2)CC1 |
| InChI | InChI=1S/C18H26N2O5S2/c1-2-25-18(22)14-7-10-19(11-8-14)17(21)15-5-3-9-20(13-15)27(23,24)16-6-4-12-26-16/h4,6,12,14-15H,2-3,5,7-11,13H2,1H3/t15-/m0/s1 |
| InChIKey | IMHDTMJLZPXGDR-HNNXBMFYSA-N |
| XLogP | 1.95 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |