C21H27N3O4S2 — CID 92802348
[4-(4-methoxyphenyl)piperazin-1-yl]-[(3S)-1-thiophen-2-ylsulfonylpiperidin-3-yl]methanone (PubChem CID 92802348) has the molecular formula C21H27N3O4S2 and a molecular weight of 449.60 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)piperazin-1-yl]-[(3S)-1-thiophen-2-ylsulfonylpiperidin-3-yl]methanone.
| Compound Name | [4-(4-methoxyphenyl)piperazin-1-yl]-[(3S)-1-thiophen-2-ylsulfonylpiperidin-3-yl]methanone |
|---|---|
| PubChem CID | 92802348 |
| Molecular Formula | C21H27N3O4S2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | [4-(4-methoxyphenyl)piperazin-1-yl]-[(3S)-1-thiophen-2-ylsulfonylpiperidin-3-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)[C@H]3CCCN(S(=O)(=O)c4cccs4)C3)CC2)cc1 |
| InChI | InChI=1S/C21H27N3O4S2/c1-28-19-8-6-18(7-9-19)22-11-13-23(14-12-22)21(25)17-4-2-10-24(16-17)30(26,27)20-5-3-15-29-20/h3,5-9,15,17H,2,4,10-14,16H2,1H3/t17-/m0/s1 |
| InChIKey | HWBFSCJLNOJWIC-KRWDZBQOSA-N |
| XLogP | 2.51 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|